C17H21NO2 — CID 15497988
(4aS,5R,6S,8aR)-3-benzyl-5,6-dimethyl-4a,5,6,8a-tetrahydro-1H-2,3-benzoxazin-4-one (PubChem CID 15497988) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (4aS,5R,6S,8aR)-3-benzyl-5,6-dimethyl-4a,5,6,8a-tetrahydro-1H-2,3-benzoxazin-4-one.
| Compound Name | (4aS,5R,6S,8aR)-3-benzyl-5,6-dimethyl-4a,5,6,8a-tetrahydro-1H-2,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 15497988 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (4aS,5R,6S,8aR)-3-benzyl-5,6-dimethyl-4a,5,6,8a-tetrahydro-1H-2,3-benzoxazin-4-one |
| SMILES | C[C@H]1[C@@H]2C(=O)N(Cc3ccccc3)OC[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C17H21NO2/c1-12-8-9-15-11-20-18(17(19)16(15)13(12)2)10-14-6-4-3-5-7-14/h3-9,12-13,15-16H,10-11H2,1-2H3/t12-,13+,15-,16-/m0/s1 |
| InChIKey | DDEIHVJGLJHUTO-XRGAULLZSA-N |
| XLogP | 3.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|