C28H27NO2 — CID 91235901
(1S,4aS,5R,6R,8aS)-3-benzyl-1-methyl-5,6-diphenyl-4a,5,6,8a-tetrahydro-1H-2,3-benzoxazin-4-one (PubChem CID 91235901) has the molecular formula C28H27NO2 and a molecular weight of 409.53 g/mol. Its IUPAC name is (1S,4aS,5R,6R,8aS)-3-benzyl-1-methyl-5,6-diphenyl-4a,5,6,8a-tetrahydro-1H-2,3-benzoxazin-4-one.
| Compound Name | (1S,4aS,5R,6R,8aS)-3-benzyl-1-methyl-5,6-diphenyl-4a,5,6,8a-tetrahydro-1H-2,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 91235901 |
| Molecular Formula | C28H27NO2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (1S,4aS,5R,6R,8aS)-3-benzyl-1-methyl-5,6-diphenyl-4a,5,6,8a-tetrahydro-1H-2,3-benzoxazin-4-one |
| SMILES | C[C@@H]1ON(Cc2ccccc2)C(=O)[C@@H]2[C@@H]1C=C[C@@H](c1ccccc1)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C28H27NO2/c1-20-24-17-18-25(22-13-7-3-8-14-22)26(23-15-9-4-10-16-23)27(24)28(30)29(31-20)19-21-11-5-2-6-12-21/h2-18,20,24-27H,19H2,1H3/t20-,24+,25-,26+,27+/m0/s1 |
| InChIKey | BWIPYCJDAIAABI-KEKNZTIFSA-N |
| XLogP | 5.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|