C17H27O5P — CID 102467744
1-di(propan-2-yloxy)phosphoryl-1-hydroxy-1-phenylpentan-3-one (PubChem CID 102467744) has the molecular formula C17H27O5P and a molecular weight of 342.37 g/mol. Its IUPAC name is 1-di(propan-2-yloxy)phosphoryl-1-hydroxy-1-phenylpentan-3-one.
| Compound Name | 1-di(propan-2-yloxy)phosphoryl-1-hydroxy-1-phenylpentan-3-one |
|---|---|
| PubChem CID | 102467744 |
| Molecular Formula | C17H27O5P |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-di(propan-2-yloxy)phosphoryl-1-hydroxy-1-phenylpentan-3-one |
| SMILES | CCC(=O)CC(O)(c1ccccc1)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C17H27O5P/c1-6-16(18)12-17(19,15-10-8-7-9-11-15)23(20,21-13(2)3)22-14(4)5/h7-11,13-14,19H,6,12H2,1-5H3 |
| InChIKey | UGFQLZUGSBTNFG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|