C14H15Cl2NO4 — CID 102468792
1-[1-(2,4-dichlorophenyl)ethyl]-4-hydroxy-3-(hydroxymethyl)-3-methylpyrrolidine-2,5-dione (PubChem CID 102468792) has the molecular formula C14H15Cl2NO4 and a molecular weight of 332.18 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-4-hydroxy-3-(hydroxymethyl)-3-methylpyrrolidine-2,5-dione.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-4-hydroxy-3-(hydroxymethyl)-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 102468792 |
| Molecular Formula | C14H15Cl2NO4 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-4-hydroxy-3-(hydroxymethyl)-3-methylpyrrolidine-2,5-dione |
| SMILES | CC(c1ccc(Cl)cc1Cl)N1C(=O)C(O)C(C)(CO)C1=O |
| InChI | InChI=1S/C14H15Cl2NO4/c1-7(9-4-3-8(15)5-10(9)16)17-12(20)11(19)14(2,6-18)13(17)21/h3-5,7,11,18-19H,6H2,1-2H3 |
| InChIKey | RKTHFOUULYEFAX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|