C7H11F3NO4S- — CID 102470557
[(1S,2S)-1-carboxy-2-methylbutyl]-(trifluoromethylsulfonyl)azanide (PubChem CID 102470557) has the molecular formula C7H11F3NO4S- and a molecular weight of 262.23 g/mol. Its IUPAC name is [(1S,2S)-1-carboxy-2-methylbutyl]-(trifluoromethylsulfonyl)azanide.
| Compound Name | [(1S,2S)-1-carboxy-2-methylbutyl]-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 102470557 |
| Molecular Formula | C7H11F3NO4S- |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | [(1S,2S)-1-carboxy-2-methylbutyl]-(trifluoromethylsulfonyl)azanide |
| SMILES | CC[C@H](C)[C@H]([N-]S(=O)(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C7H11F3NO4S/c1-3-4(2)5(6(12)13)11-16(14,15)7(8,9)10/h4-5H,3H2,1-2H3,(H,12,13)/q-1/t4-,5-/m0/s1 |
| InChIKey | NUZWESXIUCYBDH-WHFBIAKZSA-N |
| XLogP | 1.71 |
| TPSA | 85.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |