C14H26S2 — CID 102471922
2-(3,7-dimethyloct-6-enyl)-1,3-dithiane (PubChem CID 102471922) has the molecular formula C14H26S2 and a molecular weight of 258.50 g/mol. Its IUPAC name is 2-(3,7-dimethyloct-6-enyl)-1,3-dithiane.
| Compound Name | 2-(3,7-dimethyloct-6-enyl)-1,3-dithiane |
|---|---|
| PubChem CID | 102471922 |
| Molecular Formula | C14H26S2 |
| Molecular Weight | 258.50 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-(3,7-dimethyloct-6-enyl)-1,3-dithiane |
| SMILES | CC(C)=CCCC(C)CCC1SCCCS1 |
| InChI | InChI=1S/C14H26S2/c1-12(2)6-4-7-13(3)8-9-14-15-10-5-11-16-14/h6,13-14H,4-5,7-11H2,1-3H3 |
| InChIKey | ORPAVZBZIJVRLJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|