C21H11ClN2O2S — CID 102472103
3-chloro-6-(2-nitrophenyl)-[1]benzothiolo[3,2-c]quinoline (PubChem CID 102472103) has the molecular formula C21H11ClN2O2S and a molecular weight of 390.85 g/mol. Its IUPAC name is 3-chloro-6-(2-nitrophenyl)-[1]benzothiolo[3,2-c]quinoline.
| Compound Name | 3-chloro-6-(2-nitrophenyl)-[1]benzothiolo[3,2-c]quinoline |
|---|---|
| PubChem CID | 102472103 |
| Molecular Formula | C21H11ClN2O2S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 3-chloro-6-(2-nitrophenyl)-[1]benzothiolo[3,2-c]quinoline |
| SMILES | O=[N+]([O-])c1ccccc1-c1nc2cc(Cl)ccc2c2sc3ccccc3c12 |
| InChI | InChI=1S/C21H11ClN2O2S/c22-12-9-10-13-16(11-12)23-20(14-5-1-3-7-17(14)24(25)26)19-15-6-2-4-8-18(15)27-21(13)19/h1-11H |
| InChIKey | LGNAACBIDQHOMH-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|