C28H15NO2S2 — CID 147782863
11-(2-nitrophenyl)-9,17-dithiahexacyclo[11.11.0.02,10.03,8.016,24.018,23]tetracosa-1,3,5,7,10,12,14,16(24),18,20,22-undecaene (PubChem CID 147782863) has the molecular formula C28H15NO2S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 11-(2-nitrophenyl)-9,17-dithiahexacyclo[11.11.0.02,10.03,8.016,24.018,23]tetracosa-1,3,5,7,10,12,14,16(24),18,20,22-undecaene.
| Compound Name | 11-(2-nitrophenyl)-9,17-dithiahexacyclo[11.11.0.02,10.03,8.016,24.018,23]tetracosa-1,3,5,7,10,12,14,16(24),18,20,22-undecaene |
|---|---|
| PubChem CID | 147782863 |
| Molecular Formula | C28H15NO2S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 11-(2-nitrophenyl)-9,17-dithiahexacyclo[11.11.0.02,10.03,8.016,24.018,23]tetracosa-1,3,5,7,10,12,14,16(24),18,20,22-undecaene |
| SMILES | O=[N+]([O-])c1ccccc1-c1cc2ccc3sc4ccccc4c3c2c2c1sc1ccccc12 |
| InChI | InChI=1S/C28H15NO2S2/c30-29(31)21-10-4-1-7-17(21)20-15-16-13-14-24-26(18-8-2-5-11-22(18)32-24)25(16)27-19-9-3-6-12-23(19)33-28(20)27/h1-15H |
| InChIKey | SVRNNJSQXVMXLE-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|