C26H15NO2S — CID 134338033
11-(2-nitrophenyl)-9-thiapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1,3,5,7,10,12,14,16,18,20-decaene (PubChem CID 134338033) has the molecular formula C26H15NO2S and a molecular weight of 405.48 g/mol. Its IUPAC name is 11-(2-nitrophenyl)-9-thiapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1,3,5,7,10,12,14,16,18,20-decaene.
| Compound Name | 11-(2-nitrophenyl)-9-thiapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1,3,5,7,10,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 134338033 |
| Molecular Formula | C26H15NO2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 11-(2-nitrophenyl)-9-thiapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1,3,5,7,10,12,14,16,18,20-decaene |
| SMILES | O=[N+]([O-])c1ccccc1-c1cc2ccc3ccccc3c2c2c1sc1ccccc12 |
| InChI | InChI=1S/C26H15NO2S/c28-27(29)22-11-5-3-9-19(22)21-15-17-14-13-16-7-1-2-8-18(16)24(17)25-20-10-4-6-12-23(20)30-26(21)25/h1-15H |
| InChIKey | POOHDQROOYPSPA-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|