C26H15NO2S — CID 155631717
5-(3-deuterionaphthalen-1-yl)-6-nitronaphtho[1,2-b][1]benzothiole (PubChem CID 155631717) has the molecular formula C26H15NO2S and a molecular weight of 406.48 g/mol. Its IUPAC name is 5-(3-deuterionaphthalen-1-yl)-6-nitronaphtho[1,2-b][1]benzothiole.
| Compound Name | 5-(3-deuterionaphthalen-1-yl)-6-nitronaphtho[1,2-b][1]benzothiole |
|---|---|
| PubChem CID | 155631717 |
| Molecular Formula | C26H15NO2S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 5-(3-deuterionaphthalen-1-yl)-6-nitronaphtho[1,2-b][1]benzothiole |
| SMILES | [2H]c1cc(-c2c([N+](=O)[O-])c3c4ccccc4sc3c3ccccc23)c2ccccc2c1 |
| InChI | InChI=1S/C26H15NO2S/c28-27(29)25-23(18-14-7-9-16-8-1-2-10-17(16)18)19-11-3-4-12-20(19)26-24(25)21-13-5-6-15-22(21)30-26/h1-15H/i7D |
| InChIKey | GKLGPZLEIHKRHV-WHRKIXHSSA-N |
| XLogP | 7.94 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|