C26H15NO2S2 — CID 155631552
1-(6-nitronaphtho[2,1-b][1]benzothiol-5-yl)naphthalene-2-thiol (PubChem CID 155631552) has the molecular formula C26H15NO2S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 1-(6-nitronaphtho[2,1-b][1]benzothiol-5-yl)naphthalene-2-thiol.
| Compound Name | 1-(6-nitronaphtho[2,1-b][1]benzothiol-5-yl)naphthalene-2-thiol |
|---|---|
| PubChem CID | 155631552 |
| Molecular Formula | C26H15NO2S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 1-(6-nitronaphtho[2,1-b][1]benzothiol-5-yl)naphthalene-2-thiol |
| SMILES | O=[N+]([O-])c1c(-c2c(S)ccc3ccccc23)c2ccccc2c2c1sc1ccccc12 |
| InChI | InChI=1S/C26H15NO2S2/c28-27(29)25-24(23-16-8-2-1-7-15(16)13-14-20(23)30)18-10-4-3-9-17(18)22-19-11-5-6-12-21(19)31-26(22)25/h1-14,30H |
| InChIKey | KTEXIOMZIMTZDW-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 43.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|