C29H20BrNO2S — CID 155631615
5-[2-(2-bromopropan-2-yl)naphthalen-1-yl]-6-nitronaphtho[1,2-b][1]benzothiole (PubChem CID 155631615) has the molecular formula C29H20BrNO2S and a molecular weight of 526.46 g/mol. Its IUPAC name is 5-[2-(2-bromopropan-2-yl)naphthalen-1-yl]-6-nitronaphtho[1,2-b][1]benzothiole.
| Compound Name | 5-[2-(2-bromopropan-2-yl)naphthalen-1-yl]-6-nitronaphtho[1,2-b][1]benzothiole |
|---|---|
| PubChem CID | 155631615 |
| Molecular Formula | C29H20BrNO2S |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 525.04 |
| IUPAC Name | 5-[2-(2-bromopropan-2-yl)naphthalen-1-yl]-6-nitronaphtho[1,2-b][1]benzothiole |
| SMILES | CC(C)(Br)c1ccc2ccccc2c1-c1c([N+](=O)[O-])c2c3ccccc3sc2c2ccccc12 |
| InChI | InChI=1S/C29H20BrNO2S/c1-29(2,30)22-16-15-17-9-3-4-10-18(17)24(22)25-19-11-5-6-12-20(19)28-26(27(25)31(32)33)21-13-7-8-14-23(21)34-28/h3-16H,1-2H3 |
| InChIKey | BNEQLIZYPZCSBC-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|