C26H28N2O2 — CID 102472388
3,3-dimethyl-5-(2-phenylethyl)-4,8,9,13b-tetrahydro-2H-isoquinolino[2,1-c]quinazoline-1,6-dione (PubChem CID 102472388) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 3,3-dimethyl-5-(2-phenylethyl)-4,8,9,13b-tetrahydro-2H-isoquinolino[2,1-c]quinazoline-1,6-dione.
| Compound Name | 3,3-dimethyl-5-(2-phenylethyl)-4,8,9,13b-tetrahydro-2H-isoquinolino[2,1-c]quinazoline-1,6-dione |
|---|---|
| PubChem CID | 102472388 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 3,3-dimethyl-5-(2-phenylethyl)-4,8,9,13b-tetrahydro-2H-isoquinolino[2,1-c]quinazoline-1,6-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(CCc1ccccc1)C(=O)N1CCc3ccccc3C21 |
| InChI | InChI=1S/C26H28N2O2/c1-26(2)16-21-23(22(29)17-26)24-20-11-7-6-10-19(20)13-15-28(24)25(30)27(21)14-12-18-8-4-3-5-9-18/h3-11,24H,12-17H2,1-2H3 |
| InChIKey | LNUYTMJXLAQSHK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |