C26H26N2O2 — CID 10960324
(12Z)-12-(anilinomethylidene)-3,3-dimethyl-4,6,7,11b-tetrahydro-2H-isoquinolino[2,1-a]quinoline-1,13-dione (PubChem CID 10960324) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is (12Z)-12-(anilinomethylidene)-3,3-dimethyl-4,6,7,11b-tetrahydro-2H-isoquinolino[2,1-a]quinoline-1,13-dione.
| Compound Name | (12Z)-12-(anilinomethylidene)-3,3-dimethyl-4,6,7,11b-tetrahydro-2H-isoquinolino[2,1-a]quinoline-1,13-dione |
|---|---|
| PubChem CID | 10960324 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (12Z)-12-(anilinomethylidene)-3,3-dimethyl-4,6,7,11b-tetrahydro-2H-isoquinolino[2,1-a]quinoline-1,13-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N1CCc3ccccc3C1/C(=C/Nc1ccccc1)C2=O |
| InChI | InChI=1S/C26H26N2O2/c1-26(2)14-21-23(22(29)15-26)25(30)20(16-27-18-9-4-3-5-10-18)24-19-11-7-6-8-17(19)12-13-28(21)24/h3-11,16,24,27H,12-15H2,1-2H3/b20-16- |
| InChIKey | MBNKJEOXSRIKFX-SILNSSARSA-N |
| XLogP | 4.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|