C23H23NO3 — CID 102474479
(1R,14S)-21-ethyl-8,17-dimethyl-4,12-dioxa-21-azapentacyclo[12.8.0.02,11.05,10.015,20]docosa-2(11),5(10),6,8,15(20),16,18-heptaen-3-one (PubChem CID 102474479) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is (1R,14S)-21-ethyl-8,17-dimethyl-4,12-dioxa-21-azapentacyclo[12.8.0.02,11.05,10.015,20]docosa-2(11),5(10),6,8,15(20),16,18-heptaen-3-one.
| Compound Name | (1R,14S)-21-ethyl-8,17-dimethyl-4,12-dioxa-21-azapentacyclo[12.8.0.02,11.05,10.015,20]docosa-2(11),5(10),6,8,15(20),16,18-heptaen-3-one |
|---|---|
| PubChem CID | 102474479 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (1R,14S)-21-ethyl-8,17-dimethyl-4,12-dioxa-21-azapentacyclo[12.8.0.02,11.05,10.015,20]docosa-2(11),5(10),6,8,15(20),16,18-heptaen-3-one |
| SMILES | CCN1C[C@H]2c3c(c4cc(C)ccc4oc3=O)OC[C@@H]2c2cc(C)ccc21 |
| InChI | InChI=1S/C23H23NO3/c1-4-24-11-17-18(15-9-13(2)5-7-19(15)24)12-26-22-16-10-14(3)6-8-20(16)27-23(25)21(17)22/h5-10,17-18H,4,11-12H2,1-3H3/t17-,18-/m1/s1 |
| InChIKey | NAGNCBOOCYLMCO-QZTJIDSGSA-N |
| XLogP | 4.51 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|