C22H21NO3 — CID 102474485
(1S,14S)-8,17,21-trimethyl-4,12-dioxa-21-azapentacyclo[12.8.0.02,11.05,10.015,20]docosa-2(11),5(10),6,8,15(20),16,18-heptaen-3-one (PubChem CID 102474485) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is (1S,14S)-8,17,21-trimethyl-4,12-dioxa-21-azapentacyclo[12.8.0.02,11.05,10.015,20]docosa-2(11),5(10),6,8,15(20),16,18-heptaen-3-one.
| Compound Name | (1S,14S)-8,17,21-trimethyl-4,12-dioxa-21-azapentacyclo[12.8.0.02,11.05,10.015,20]docosa-2(11),5(10),6,8,15(20),16,18-heptaen-3-one |
|---|---|
| PubChem CID | 102474485 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (1S,14S)-8,17,21-trimethyl-4,12-dioxa-21-azapentacyclo[12.8.0.02,11.05,10.015,20]docosa-2(11),5(10),6,8,15(20),16,18-heptaen-3-one |
| SMILES | Cc1ccc2c(c1)[C@H]1COc3c(c(=O)oc4ccc(C)cc34)[C@H]1CN2C |
| InChI | InChI=1S/C22H21NO3/c1-12-4-6-18-14(8-12)17-11-25-21-15-9-13(2)5-7-19(15)26-22(24)20(21)16(17)10-23(18)3/h4-9,16-17H,10-11H2,1-3H3/t16-,17+/m0/s1 |
| InChIKey | VTDNWMVXHWQNRN-DLBZAZTESA-N |
| XLogP | 4.12 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|