C21H23N3O5 — CID 102218617
1'-ethyl-1,2',3,9'-tetramethylspiro[1,3-diazinane-5,3'-2,4-dihydrochromeno[4,3-b]pyridine]-2,4,5',6-tetrone (PubChem CID 102218617) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 1'-ethyl-1,2',3,9'-tetramethylspiro[1,3-diazinane-5,3'-2,4-dihydrochromeno[4,3-b]pyridine]-2,4,5',6-tetrone.
| Compound Name | 1'-ethyl-1,2',3,9'-tetramethylspiro[1,3-diazinane-5,3'-2,4-dihydrochromeno[4,3-b]pyridine]-2,4,5',6-tetrone |
|---|---|
| PubChem CID | 102218617 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1'-ethyl-1,2',3,9'-tetramethylspiro[1,3-diazinane-5,3'-2,4-dihydrochromeno[4,3-b]pyridine]-2,4,5',6-tetrone |
| SMILES | CCN1c2c(c(=O)oc3ccc(C)cc23)CC2(C(=O)N(C)C(=O)N(C)C2=O)C1C |
| InChI | InChI=1S/C21H23N3O5/c1-6-24-12(3)21(18(26)22(4)20(28)23(5)19(21)27)10-14-16(24)13-9-11(2)7-8-15(13)29-17(14)25/h7-9,12H,6,10H2,1-5H3 |
| InChIKey | YUCYYQHADCFYBW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|