C16H15IO3 — CID 23656865
10-iodo-2-methyl-6b,7,8,9,10,10a-hexahydro-[1]benzofuro[3,2-c]chromen-6-one (PubChem CID 23656865) has the molecular formula C16H15IO3 and a molecular weight of 382.20 g/mol. Its IUPAC name is 10-iodo-2-methyl-6b,7,8,9,10,10a-hexahydro-[1]benzofuro[3,2-c]chromen-6-one.
| Compound Name | 10-iodo-2-methyl-6b,7,8,9,10,10a-hexahydro-[1]benzofuro[3,2-c]chromen-6-one |
|---|---|
| PubChem CID | 23656865 |
| Molecular Formula | C16H15IO3 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 10-iodo-2-methyl-6b,7,8,9,10,10a-hexahydro-[1]benzofuro[3,2-c]chromen-6-one |
| SMILES | Cc1ccc2oc(=O)c3c(c2c1)OC1C(I)CCCC31 |
| InChI | InChI=1S/C16H15IO3/c1-8-5-6-12-10(7-8)15-13(16(18)19-12)9-3-2-4-11(17)14(9)20-15/h5-7,9,11,14H,2-4H2,1H3 |
| InChIKey | HSIYJVSOGUNUAG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|