C16H12F6O3 — CID 102475198
1,1,1,5,5,5-hexafluoro-3-[(E)-3-(3-methoxy-4-methylphenyl)prop-2-enylidene]pentane-2,4-dione (PubChem CID 102475198) has the molecular formula C16H12F6O3 and a molecular weight of 366.26 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-3-[(E)-3-(3-methoxy-4-methylphenyl)prop-2-enylidene]pentane-2,4-dione.
| Compound Name | 1,1,1,5,5,5-hexafluoro-3-[(E)-3-(3-methoxy-4-methylphenyl)prop-2-enylidene]pentane-2,4-dione |
|---|---|
| PubChem CID | 102475198 |
| Molecular Formula | C16H12F6O3 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-3-[(E)-3-(3-methoxy-4-methylphenyl)prop-2-enylidene]pentane-2,4-dione |
| SMILES | COc1cc(/C=C/C=C(C(=O)C(F)(F)F)C(=O)C(F)(F)F)ccc1C |
| InChI | InChI=1S/C16H12F6O3/c1-9-6-7-10(8-12(9)25-2)4-3-5-11(13(23)15(17,18)19)14(24)16(20,21)22/h3-8H,1-2H3/b4-3+ |
| InChIKey | HTQNQMOBXDSRGX-ONEGZZNKSA-N |
| XLogP | 4.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|