C18H25ClO3 — CID 143996420
tert-butyl (2E)-5-chloro-2-[(3-methoxy-4-methylphenyl)methylidene]pentanoate (PubChem CID 143996420) has the molecular formula C18H25ClO3 and a molecular weight of 324.85 g/mol. Its IUPAC name is tert-butyl (2E)-5-chloro-2-[(3-methoxy-4-methylphenyl)methylidene]pentanoate.
| Compound Name | tert-butyl (2E)-5-chloro-2-[(3-methoxy-4-methylphenyl)methylidene]pentanoate |
|---|---|
| PubChem CID | 143996420 |
| Molecular Formula | C18H25ClO3 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | tert-butyl (2E)-5-chloro-2-[(3-methoxy-4-methylphenyl)methylidene]pentanoate |
| SMILES | COc1cc(/C=C(\CCCCl)C(=O)OC(C)(C)C)ccc1C |
| InChI | InChI=1S/C18H25ClO3/c1-13-8-9-14(12-16(13)21-5)11-15(7-6-10-19)17(20)22-18(2,3)4/h8-9,11-12H,6-7,10H2,1-5H3/b15-11+ |
| InChIKey | HFVHTTCFMTUZBJ-RVDMUPIBSA-N |
| XLogP | 4.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|