C32H22Cl2N2O3S2 — CID 102476402
2-[(5Z)-5-[[2,5-dichloro-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 102476402) has the molecular formula C32H22Cl2N2O3S2 and a molecular weight of 617.58 g/mol. Its IUPAC name is 2-[(5Z)-5-[[2,5-dichloro-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[2,5-dichloro-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 102476402 |
| Molecular Formula | C32H22Cl2N2O3S2 |
| Molecular Weight | 617.58 g/mol |
| Exact Mass | 616.04 |
| IUPAC Name | 2-[(5Z)-5-[[2,5-dichloro-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)/C(=C/c2cc(Cl)c(/C=C/c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2Cl)SC1=S |
| InChI | InChI=1S/C32H22Cl2N2O3S2/c33-27-18-23(19-29-31(39)35(20-30(37)38)32(40)41-29)28(34)17-22(27)14-11-21-12-15-26(16-13-21)36(24-7-3-1-4-8-24)25-9-5-2-6-10-25/h1-19H,20H2,(H,37,38)/b14-11+,29-19- |
| InChIKey | JSISUGNHQNRXJI-FPGPKZNPSA-N |
| XLogP | 8.92 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.58 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|