C20H23NO3S — CID 10247765
(E)-N-(4-hydroxybutyl)-3-[2-(4-methoxyphenyl)sulfanylphenyl]prop-2-enamide (PubChem CID 10247765) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is (E)-N-(4-hydroxybutyl)-3-[2-(4-methoxyphenyl)sulfanylphenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-hydroxybutyl)-3-[2-(4-methoxyphenyl)sulfanylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 10247765 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (E)-N-(4-hydroxybutyl)-3-[2-(4-methoxyphenyl)sulfanylphenyl]prop-2-enamide |
| SMILES | COc1ccc(Sc2ccccc2/C=C/C(=O)NCCCCO)cc1 |
| InChI | InChI=1S/C20H23NO3S/c1-24-17-9-11-18(12-10-17)25-19-7-3-2-6-16(19)8-13-20(23)21-14-4-5-15-22/h2-3,6-13,22H,4-5,14-15H2,1H3,(H,21,23)/b13-8+ |
| InChIKey | BKBLPYQBOSQPIT-MDWZMJQESA-N |
| XLogP | 3.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|