C20H22Cl2N2OS — CID 11463977
(E)-3-[2-(3,5-dichlorophenyl)sulfanylphenyl]-N-[3-(dimethylamino)propyl]prop-2-enamide (PubChem CID 11463977) has the molecular formula C20H22Cl2N2OS and a molecular weight of 409.38 g/mol. Its IUPAC name is (E)-3-[2-(3,5-dichlorophenyl)sulfanylphenyl]-N-[3-(dimethylamino)propyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(3,5-dichlorophenyl)sulfanylphenyl]-N-[3-(dimethylamino)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 11463977 |
| Molecular Formula | C20H22Cl2N2OS |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (E)-3-[2-(3,5-dichlorophenyl)sulfanylphenyl]-N-[3-(dimethylamino)propyl]prop-2-enamide |
| SMILES | CN(C)CCCNC(=O)/C=C/c1ccccc1Sc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H22Cl2N2OS/c1-24(2)11-5-10-23-20(25)9-8-15-6-3-4-7-19(15)26-18-13-16(21)12-17(22)14-18/h3-4,6-9,12-14H,5,10-11H2,1-2H3,(H,23,25)/b9-8+ |
| InChIKey | DMUCVIDIFKQPPR-CMDGGOBGSA-N |
| XLogP | 5.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|