C20H25NO3S — CID 102478830
1-[(3aS,8aS)-5-methyl-8-methylidene-2-(4-methylphenyl)sulfonyl-1,3,3a,4,7,8a-hexahydrocyclohepta[c]pyrrol-6-yl]ethanone (PubChem CID 102478830) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is 1-[(3aS,8aS)-5-methyl-8-methylidene-2-(4-methylphenyl)sulfonyl-1,3,3a,4,7,8a-hexahydrocyclohepta[c]pyrrol-6-yl]ethanone.
| Compound Name | 1-[(3aS,8aS)-5-methyl-8-methylidene-2-(4-methylphenyl)sulfonyl-1,3,3a,4,7,8a-hexahydrocyclohepta[c]pyrrol-6-yl]ethanone |
|---|---|
| PubChem CID | 102478830 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-[(3aS,8aS)-5-methyl-8-methylidene-2-(4-methylphenyl)sulfonyl-1,3,3a,4,7,8a-hexahydrocyclohepta[c]pyrrol-6-yl]ethanone |
| SMILES | C=C1CC(C(C)=O)=C(C)C[C@@H]2CN(S(=O)(=O)c3ccc(C)cc3)C[C@H]12 |
| InChI | InChI=1S/C20H25NO3S/c1-13-5-7-18(8-6-13)25(23,24)21-11-17-9-14(2)19(16(4)22)10-15(3)20(17)12-21/h5-8,17,20H,3,9-12H2,1-2,4H3/t17-,20-/m1/s1 |
| InChIKey | QPPBUMWCKYCOJP-YLJYHZDGSA-N |
| XLogP | 3.49 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|