C22H12Cl2F3N3 — CID 102481553
2,4-bis(2-chlorophenyl)-6-[4-(trifluoromethyl)phenyl]-1,3,5-triazine (PubChem CID 102481553) has the molecular formula C22H12Cl2F3N3 and a molecular weight of 446.26 g/mol. Its IUPAC name is 2,4-bis(2-chlorophenyl)-6-[4-(trifluoromethyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(2-chlorophenyl)-6-[4-(trifluoromethyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 102481553 |
| Molecular Formula | C22H12Cl2F3N3 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 2,4-bis(2-chlorophenyl)-6-[4-(trifluoromethyl)phenyl]-1,3,5-triazine |
| SMILES | FC(F)(F)c1ccc(-c2nc(-c3ccccc3Cl)nc(-c3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C22H12Cl2F3N3/c23-17-7-3-1-5-15(17)20-28-19(13-9-11-14(12-10-13)22(25,26)27)29-21(30-20)16-6-2-4-8-18(16)24/h1-12H |
| InChIKey | DIWMXSPWLIWBSR-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |