C16H16Cl3N2O2P — CID 102482763
1-bis(benzylamino)phosphoryl-2,2,2-trichloroethanone (PubChem CID 102482763) has the molecular formula C16H16Cl3N2O2P and a molecular weight of 405.65 g/mol. Its IUPAC name is 1-bis(benzylamino)phosphoryl-2,2,2-trichloroethanone.
| Compound Name | 1-bis(benzylamino)phosphoryl-2,2,2-trichloroethanone |
|---|---|
| PubChem CID | 102482763 |
| Molecular Formula | C16H16Cl3N2O2P |
| Molecular Weight | 405.65 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | 1-bis(benzylamino)phosphoryl-2,2,2-trichloroethanone |
| SMILES | O=C(C(Cl)(Cl)Cl)P(=O)(NCc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C16H16Cl3N2O2P/c17-16(18,19)15(22)24(23,20-11-13-7-3-1-4-8-13)21-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H2,20,21,23) |
| InChIKey | YMDXTXLJWVKYBE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|