C16H24O3 — CID 102483802
[(2S,4R,5S,8S)-2,8-dimethyl-3-oxatetracyclo[5.3.3.01,7.02,4]tridecan-5-yl] acetate (PubChem CID 102483802) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is [(2S,4R,5S,8S)-2,8-dimethyl-3-oxatetracyclo[5.3.3.01,7.02,4]tridecan-5-yl] acetate.
| Compound Name | [(2S,4R,5S,8S)-2,8-dimethyl-3-oxatetracyclo[5.3.3.01,7.02,4]tridecan-5-yl] acetate |
|---|---|
| PubChem CID | 102483802 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [(2S,4R,5S,8S)-2,8-dimethyl-3-oxatetracyclo[5.3.3.01,7.02,4]tridecan-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC23CCCC2(CC[C@@H]3C)[C@]2(C)O[C@H]12 |
| InChI | InChI=1S/C16H24O3/c1-10-5-8-16-7-4-6-15(10,16)9-12(18-11(2)17)13-14(16,3)19-13/h10,12-13H,4-9H2,1-3H3/t10-,12-,13+,14+,15?,16?/m0/s1 |
| InChIKey | HNTAZNNIPQUEGB-YPMVPXSXSA-N |
| XLogP | 3.07 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|