C18H27NO7 — CID 10248513
(3S)-5-(3-cyclohexylpropanoyloxy)-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoic acid (PubChem CID 10248513) has the molecular formula C18H27NO7 and a molecular weight of 369.41 g/mol. Its IUPAC name is (3S)-5-(3-cyclohexylpropanoyloxy)-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoic acid.
| Compound Name | (3S)-5-(3-cyclohexylpropanoyloxy)-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 10248513 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (3S)-5-(3-cyclohexylpropanoyloxy)-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoic acid |
| SMILES | C=CCOC(=O)N[C@@H](CC(=O)O)C(=O)COC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C18H27NO7/c1-2-10-25-18(24)19-14(11-16(21)22)15(20)12-26-17(23)9-8-13-6-4-3-5-7-13/h2,13-14H,1,3-12H2,(H,19,24)(H,21,22)/t14-/m0/s1 |
| InChIKey | HEJMILSAQRJXFS-AWEZNQCLSA-N |
| XLogP | 2.21 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|