About 2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate
2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate (PubChem CID 174974194) has the molecular formula C23H30O3
and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate.
Molecular Properties
| Compound Name | 2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate |
| PubChem CID | 174974194 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate |
| SMILES | C=CCOC(=O)CCC1CCCCC1.COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H20O2.C11H10O/c1-2-10-14-12(13)9-8-11-6-4-3-5-7-11;1-12-11-7-6-9-4-2-3-5-10(9)8-11/h2,11H,1,3-10H2;2-8H,1H3 |
| InChIKey | LPBFNZVEPPKBGI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate?
The IUPAC name of 2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate (CID 174974194) is 2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate.
What is the SMILES notation for 2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate?
The canonical SMILES for 2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate is C=CCOC(=O)CCC1CCCCC1.COc1ccc2ccccc2c1.
What is the InChIKey of 2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate?
The InChIKey is LPBFNZVEPPKBGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2.C11H10O/c1-2-10-14-12(13)9-8-11-6-4-3-5-7-11;1-12-11-7-6-9-4-2-3-5-10(9)8-11/h2,11H,1,3-10H2;2-8H,1H3.
What are the key properties of 2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate?
2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate has a molecular weight of 354.49 g/mol, XLogP of 5.92, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxynaphthalene;prop-2-enyl 3-cyclohexylpropanoate is sourced from PubChem (CID 174974194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).