C26H28O13 — CID 102487698
(2S,3R,4S,5S,6R)-2-[[(3R,3aS,4R,6R,6aR)-3,6-bis(1,3-benzodioxol-5-yl)-4-hydroxy-3,3a,4,6-tetrahydro-1H-furo[3,4-c]furan-6a-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 102487698) has the molecular formula C26H28O13 and a molecular weight of 548.50 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[[(3R,3aS,4R,6R,6aR)-3,6-bis(1,3-benzodioxol-5-yl)-4-hydroxy-3,3a,4,6-tetrahydro-1H-furo[3,4-c]furan-6a-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[[(3R,3aS,4R,6R,6aR)-3,6-bis(1,3-benzodioxol-5-yl)-4-hydroxy-3,3a,4,6-tetrahydro-1H-furo[3,4-c]furan-6a-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102487698 |
| Molecular Formula | C26H28O13 |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[[(3R,3aS,4R,6R,6aR)-3,6-bis(1,3-benzodioxol-5-yl)-4-hydroxy-3,3a,4,6-tetrahydro-1H-furo[3,4-c]furan-6a-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](O[C@@]23CO[C@@H](c4ccc5c(c4)OCO5)[C@@H]2[C@H](O)O[C@@H]3c2ccc3c(c2)OCO3)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H28O13/c27-7-17-19(28)20(29)21(30)25(37-17)39-26-8-32-22(11-1-3-13-15(5-11)35-9-33-13)18(26)24(31)38-23(26)12-2-4-14-16(6-12)36-10-34-14/h1-6,17-25,27-31H,7-10H2/t17-,18-,19-,20+,21-,22+,23-,24-,25+,26+/m1/s1 |
| InChIKey | YXGGYSZMXACDEZ-AGTZLAJMSA-N |
| XLogP | -0.52 |
| TPSA | 174.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |