C21H24O8 — CID 172871534
(2S,3R,4S,5S,6R)-2-[3-[2-(1,3-benzodioxol-5-yl)ethyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 172871534) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[3-[2-(1,3-benzodioxol-5-yl)ethyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[3-[2-(1,3-benzodioxol-5-yl)ethyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 172871534 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[3-[2-(1,3-benzodioxol-5-yl)ethyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Oc2cccc(CCc3ccc4c(c3)OCO4)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H24O8/c22-10-17-18(23)19(24)20(25)21(29-17)28-14-3-1-2-12(8-14)4-5-13-6-7-15-16(9-13)27-11-26-15/h1-3,6-9,17-25H,4-5,10-11H2/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | KMDUYDVMYWNRAQ-YMQHIKHWSA-N |
| XLogP | 0.38 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |