C27H42O6 — CID 70988042
(3S,6S)-2-(hydroxymethyl)-6-[3-[(8Z,11Z)-pentadeca-8,11-dienyl]phenoxy]oxane-3,4,5-triol (PubChem CID 70988042) has the molecular formula C27H42O6 and a molecular weight of 462.63 g/mol. Its IUPAC name is (3S,6S)-2-(hydroxymethyl)-6-[3-[(8Z,11Z)-pentadeca-8,11-dienyl]phenoxy]oxane-3,4,5-triol.
| Compound Name | (3S,6S)-2-(hydroxymethyl)-6-[3-[(8Z,11Z)-pentadeca-8,11-dienyl]phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70988042 |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | (3S,6S)-2-(hydroxymethyl)-6-[3-[(8Z,11Z)-pentadeca-8,11-dienyl]phenoxy]oxane-3,4,5-triol |
| SMILES | CCC/C=C\C/C=C\CCCCCCCc1cccc(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)c1 |
| InChI | InChI=1S/C27H42O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-21-17-15-18-22(19-21)32-27-26(31)25(30)24(29)23(20-28)33-27/h4-5,7-8,15,17-19,23-31H,2-3,6,9-14,16,20H2,1H3/b5-4-,8-7-/t23?,24-,25?,26?,27-/m1/s1 |
| InChIKey | XQXVLAOFENRZMI-WOWYNBPASA-N |
| XLogP | 4.05 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|