C27H44O6 — CID 91544961
(3S,4S,6S)-2-(hydroxymethyl)-6-(3-pentadec-8-enylphenoxy)oxane-3,4,5-triol (PubChem CID 91544961) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is (3S,4S,6S)-2-(hydroxymethyl)-6-(3-pentadec-8-enylphenoxy)oxane-3,4,5-triol.
| Compound Name | (3S,4S,6S)-2-(hydroxymethyl)-6-(3-pentadec-8-enylphenoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 91544961 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | (3S,4S,6S)-2-(hydroxymethyl)-6-(3-pentadec-8-enylphenoxy)oxane-3,4,5-triol |
| SMILES | CCCCCCC=CCCCCCCCc1cccc(O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)c1 |
| InChI | InChI=1S/C27H44O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-21-17-15-18-22(19-21)32-27-26(31)25(30)24(29)23(20-28)33-27/h7-8,15,17-19,23-31H,2-6,9-14,16,20H2,1H3/t23?,24-,25+,26?,27-/m1/s1 |
| InChIKey | BAXJOGQPVIEZGH-SPBVMPTPSA-N |
| XLogP | 4.28 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|