C28H44O8 — CID 101093728
[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-hydroxy-6-[(Z)-pentadec-8-enyl]benzoate (PubChem CID 101093728) has the molecular formula C28H44O8 and a molecular weight of 508.65 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-hydroxy-6-[(Z)-pentadec-8-enyl]benzoate.
| Compound Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-hydroxy-6-[(Z)-pentadec-8-enyl]benzoate |
|---|---|
| PubChem CID | 101093728 |
| Molecular Formula | C28H44O8 |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-hydroxy-6-[(Z)-pentadec-8-enyl]benzoate |
| SMILES | CCCCCC/C=C\CCCCCCCc1cccc(O)c1C(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H44O8/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(30)23(20)27(34)36-28-26(33)25(32)24(31)22(19-29)35-28/h7-8,15,17-18,22,24-26,28-33H,2-6,9-14,16,19H2,1H3/b8-7-/t22-,24-,25+,26-,28+/m1/s1 |
| InChIKey | XNLLAENVFVAUIV-UGOVUBNTSA-N |
| XLogP | 3.76 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|