C23H34O4 — CID 10248853
(3R,4aS,7aS)-3,4a-dimethyl-3-(2-methyl-8-phenyloctyl)-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one (PubChem CID 10248853) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (3R,4aS,7aS)-3,4a-dimethyl-3-(2-methyl-8-phenyloctyl)-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one.
| Compound Name | (3R,4aS,7aS)-3,4a-dimethyl-3-(2-methyl-8-phenyloctyl)-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one |
|---|---|
| PubChem CID | 10248853 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (3R,4aS,7aS)-3,4a-dimethyl-3-(2-methyl-8-phenyloctyl)-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one |
| SMILES | CC(CCCCCCc1ccccc1)C[C@]1(C)C[C@]2(C)OC(=O)C[C@@H]2OO1 |
| InChI | InChI=1S/C23H34O4/c1-18(11-7-4-5-8-12-19-13-9-6-10-14-19)16-22(2)17-23(3)20(26-27-22)15-21(24)25-23/h6,9-10,13-14,18,20H,4-5,7-8,11-12,15-17H2,1-3H3/t18?,20-,22+,23-/m0/s1 |
| InChIKey | BJCREQAAFOADRC-OYVLRHCSSA-N |
| XLogP | 5.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|