C40H30N4 — CID 102489052
5,10,15-tris(4-methylphenyl)-21H-corrin (PubChem CID 102489052) has the molecular formula C40H30N4 and a molecular weight of 566.71 g/mol. Its IUPAC name is 5,10,15-tris(4-methylphenyl)-21H-corrin.
| Compound Name | 5,10,15-tris(4-methylphenyl)-21H-corrin |
|---|---|
| PubChem CID | 102489052 |
| Molecular Formula | C40H30N4 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 5,10,15-tris(4-methylphenyl)-21H-corrin |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(C)cc3)=C3/C=CC(=N3)/C(c3ccc(C)cc3)=c3/cc/c([nH]3)=C3\C=CC2=N3)cc1 |
| InChI | InChI=1S/C40H30N4/c1-24-4-10-27(11-5-24)38-32-18-16-30(41-32)31-17-19-33(42-31)39(28-12-6-25(2)7-13-28)35-21-23-37(44-35)40(36-22-20-34(38)43-36)29-14-8-26(3)9-15-29/h4-23,41H,1-3H3/b31-30-,38-32-,38-34-,39-33-,39-35-,40-36-,40-37- |
| InChIKey | MGTCBFUHEWBXIV-OZOLWRCISA-N |
| XLogP | 7.12 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |