C38H25IN4 — CID 137278667
(1Z,6Z,11Z)-17-iodo-6,11,16-triphenyl-21,22,23,24-tetrazapentacyclo[16.2.1.12,5.17,10.112,15]tetracosa-1,3,5(24),6,8,10(23),11,13,15,18(21),19-undecaene (PubChem CID 137278667) has the molecular formula C38H25IN4 and a molecular weight of 664.55 g/mol. Its IUPAC name is (1Z,6Z,11Z)-17-iodo-6,11,16-triphenyl-21,22,23,24-tetrazapentacyclo[16.2.1.12,5.17,10.112,15]tetracosa-1,3,5(24),6,8,10(23),11,13,15,18(21),19-undecaene.
| Compound Name | (1Z,6Z,11Z)-17-iodo-6,11,16-triphenyl-21,22,23,24-tetrazapentacyclo[16.2.1.12,5.17,10.112,15]tetracosa-1,3,5(24),6,8,10(23),11,13,15,18(21),19-undecaene |
|---|---|
| PubChem CID | 137278667 |
| Molecular Formula | C38H25IN4 |
| Molecular Weight | 664.55 g/mol |
| Exact Mass | 664.11 |
| IUPAC Name | (1Z,6Z,11Z)-17-iodo-6,11,16-triphenyl-21,22,23,24-tetrazapentacyclo[16.2.1.12,5.17,10.112,15]tetracosa-1,3,5(24),6,8,10(23),11,13,15,18(21),19-undecaene |
| SMILES | IC1C2=N/C(=C3/C=CC(=N3)/C(c3ccccc3)=C3/C=CC(=N3)/C(c3ccccc3)=c3/ccc([nH]3)=C1c1ccccc1)C=C2 |
| InChI | InChI=1S/C38H25IN4/c39-38-34-23-17-28(41-34)27-16-18-29(40-27)35(24-10-4-1-5-11-24)30-19-20-31(42-30)36(25-12-6-2-7-13-25)32-21-22-33(43-32)37(38)26-14-8-3-9-15-26/h1-23,38,43H/b28-27-,35-30-,36-32-,37-33? |
| InChIKey | DEBFCJYTRBXBQW-KZWMPFHGSA-N |
| XLogP | 6.89 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.55 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|