C25H31N3O10S3 — CID 102497776
8-hydroxy-1-N,3-N,6-N-tris(2-hydroxyethyl)-1-N,3-N,6-N-trimethylpyrene-1,3,6-trisulfonamide (PubChem CID 102497776) has the molecular formula C25H31N3O10S3 and a molecular weight of 629.73 g/mol. Its IUPAC name is 8-hydroxy-1-N,3-N,6-N-tris(2-hydroxyethyl)-1-N,3-N,6-N-trimethylpyrene-1,3,6-trisulfonamide.
| Compound Name | 8-hydroxy-1-N,3-N,6-N-tris(2-hydroxyethyl)-1-N,3-N,6-N-trimethylpyrene-1,3,6-trisulfonamide |
|---|---|
| PubChem CID | 102497776 |
| Molecular Formula | C25H31N3O10S3 |
| Molecular Weight | 629.73 g/mol |
| Exact Mass | 629.12 |
| IUPAC Name | 8-hydroxy-1-N,3-N,6-N-tris(2-hydroxyethyl)-1-N,3-N,6-N-trimethylpyrene-1,3,6-trisulfonamide |
| SMILES | CN(CCO)S(=O)(=O)c1cc(O)c2ccc3c(S(=O)(=O)N(C)CCO)cc(S(=O)(=O)N(C)CCO)c4ccc1c2c34 |
| InChI | InChI=1S/C25H31N3O10S3/c1-26(8-11-29)39(33,34)21-14-20(32)16-4-5-18-22(40(35,36)27(2)9-12-30)15-23(41(37,38)28(3)10-13-31)19-7-6-17(21)24(16)25(18)19/h4-7,14-15,29-32H,8-13H2,1-3H3 |
| InChIKey | MFMIMEXRCNLCKK-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 193.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.73 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|