C16H10Br2N2 — CID 10249779
3,4-dibromo-2-phenyl-4H-pyrazolo[1,5-a]indole (PubChem CID 10249779) has the molecular formula C16H10Br2N2 and a molecular weight of 390.08 g/mol. Its IUPAC name is 3,4-dibromo-2-phenyl-4H-pyrazolo[1,5-a]indole.
| Compound Name | 3,4-dibromo-2-phenyl-4H-pyrazolo[1,5-a]indole |
|---|---|
| PubChem CID | 10249779 |
| Molecular Formula | C16H10Br2N2 |
| Molecular Weight | 390.08 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | 3,4-dibromo-2-phenyl-4H-pyrazolo[1,5-a]indole |
| SMILES | Brc1c(-c2ccccc2)nn2c1C(Br)c1ccccc1-2 |
| InChI | InChI=1S/C16H10Br2N2/c17-13-11-8-4-5-9-12(11)20-16(13)14(18)15(19-20)10-6-2-1-3-7-10/h1-9,13H |
| InChIKey | JFXKOFOTPCPWME-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.08 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|