C17H16N2 — CID 13146064
1,5-dimethyl-3,4-diphenylpyrazole (PubChem CID 13146064) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 1,5-dimethyl-3,4-diphenylpyrazole.
| Compound Name | 1,5-dimethyl-3,4-diphenylpyrazole |
|---|---|
| PubChem CID | 13146064 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1,5-dimethyl-3,4-diphenylpyrazole |
| SMILES | Cc1c(-c2ccccc2)c(-c2ccccc2)nn1C |
| InChI | InChI=1S/C17H16N2/c1-13-16(14-9-5-3-6-10-14)17(18-19(13)2)15-11-7-4-8-12-15/h3-12H,1-2H3 |
| InChIKey | XOKDMOHNEBWUMW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |