C21H20N4 — CID 4885487
4-(4,5-diphenyl-1H-imidazol-2-yl)-1,3,5-trimethylpyrazole (PubChem CID 4885487) has the molecular formula C21H20N4 and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-(4,5-diphenyl-1H-imidazol-2-yl)-1,3,5-trimethylpyrazole.
| Compound Name | 4-(4,5-diphenyl-1H-imidazol-2-yl)-1,3,5-trimethylpyrazole |
|---|---|
| PubChem CID | 4885487 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 4-(4,5-diphenyl-1H-imidazol-2-yl)-1,3,5-trimethylpyrazole |
| SMILES | Cc1nn(C)c(C)c1-c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C21H20N4/c1-14-18(15(2)25(3)24-14)21-22-19(16-10-6-4-7-11-16)20(23-21)17-12-8-5-9-13-17/h4-13H,1-3H3,(H,22,23) |
| InChIKey | NUBUBNOTJJRGMF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|