C27H24NO3P — CID 102498328
2-[anilino-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]-4,6-dimethylphenol (PubChem CID 102498328) has the molecular formula C27H24NO3P and a molecular weight of 441.47 g/mol. Its IUPAC name is 2-[anilino-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]-4,6-dimethylphenol.
| Compound Name | 2-[anilino-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]-4,6-dimethylphenol |
|---|---|
| PubChem CID | 102498328 |
| Molecular Formula | C27H24NO3P |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-[anilino-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(C(Nc2ccccc2)P2(=O)Oc3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C27H24NO3P/c1-18-16-19(2)26(29)23(17-18)27(28-20-10-4-3-5-11-20)32(30)25-15-9-7-13-22(25)21-12-6-8-14-24(21)31-32/h3-17,27-29H,1-2H3 |
| InChIKey | GSSJIGWKOKONOS-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|