C45H45N2O8P3 — CID 177077133
methyl bis[3-[[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-phenylmethyl]amino]propyl] phosphate (PubChem CID 177077133) has the molecular formula C45H45N2O8P3 and a molecular weight of 834.78 g/mol. Its IUPAC name is methyl bis[3-[[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-phenylmethyl]amino]propyl] phosphate.
| Compound Name | methyl bis[3-[[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-phenylmethyl]amino]propyl] phosphate |
|---|---|
| PubChem CID | 177077133 |
| Molecular Formula | C45H45N2O8P3 |
| Molecular Weight | 834.78 g/mol |
| Exact Mass | 834.24 |
| IUPAC Name | methyl bis[3-[[(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-phenylmethyl]amino]propyl] phosphate |
| SMILES | COP(=O)(OCCCNC(c1ccccc1)P1(=O)Oc2ccccc2-c2ccccc21)OCCCNC(c1ccccc1)P1(=O)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C45H45N2O8P3/c1-51-58(50,52-32-16-30-46-44(34-18-4-2-5-19-34)56(48)42-28-14-10-24-38(42)36-22-8-12-26-40(36)54-56)53-33-17-31-47-45(35-20-6-3-7-21-35)57(49)43-29-15-11-25-39(43)37-23-9-13-27-41(37)55-57/h2-15,18-29,44-47H,16-17,30-33H2,1H3 |
| InChIKey | TZZKWMYZEPKFIA-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.78 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|