C20H26NO4P — CID 163455296
N-(4,4-diethoxybutyl)-6-oxobenzo[c][2,1]benzoxaphosphinin-6-amine (PubChem CID 163455296) has the molecular formula C20H26NO4P and a molecular weight of 375.41 g/mol. Its IUPAC name is N-(4,4-diethoxybutyl)-6-oxobenzo[c][2,1]benzoxaphosphinin-6-amine.
| Compound Name | N-(4,4-diethoxybutyl)-6-oxobenzo[c][2,1]benzoxaphosphinin-6-amine |
|---|---|
| PubChem CID | 163455296 |
| Molecular Formula | C20H26NO4P |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-(4,4-diethoxybutyl)-6-oxobenzo[c][2,1]benzoxaphosphinin-6-amine |
| SMILES | CCOC(CCCNP1(=O)Oc2ccccc2-c2ccccc21)OCC |
| InChI | InChI=1S/C20H26NO4P/c1-3-23-20(24-4-2)14-9-15-21-26(22)19-13-8-6-11-17(19)16-10-5-7-12-18(16)25-26/h5-8,10-13,20H,3-4,9,14-15H2,1-2H3,(H,21,22) |
| InChIKey | BJYAWBYHXUPHCI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|