C29H29ClN3O- — CID 102498580
(Z)-2-[[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]-1-(4-chlorophenyl)ethenolate (PubChem CID 102498580) has the molecular formula C29H29ClN3O- and a molecular weight of 471.02 g/mol. Its IUPAC name is (Z)-2-[[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]-1-(4-chlorophenyl)ethenolate.
| Compound Name | (Z)-2-[[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]-1-(4-chlorophenyl)ethenolate |
|---|---|
| PubChem CID | 102498580 |
| Molecular Formula | C29H29ClN3O- |
| Molecular Weight | 471.02 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | (Z)-2-[[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]-1-(4-chlorophenyl)ethenolate |
| SMILES | Cc1cc(C)c(-n2ccn(-c3c(C)cc(C)cc3C)c2=N/C=C(\[O-])c2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C29H30ClN3O/c1-18-13-20(3)27(21(4)14-18)32-11-12-33(28-22(5)15-19(2)16-23(28)6)29(32)31-17-26(34)24-7-9-25(30)10-8-24/h7-17,34H,1-6H3/p-1/b26-17- |
| InChIKey | OQXGRXNJLHEAGS-ONUIUJJFSA-M |
| XLogP | 6.03 |
| TPSA | 45.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.02 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|