C17H16F4O6S — CID 102498855
dimethyl (1S,4S)-4-(4-methylphenyl)sulfonyl-3-(1,1,2,2-tetrafluoroethyl)cyclobut-2-ene-1,2-dicarboxylate (PubChem CID 102498855) has the molecular formula C17H16F4O6S and a molecular weight of 424.37 g/mol. Its IUPAC name is dimethyl (1S,4S)-4-(4-methylphenyl)sulfonyl-3-(1,1,2,2-tetrafluoroethyl)cyclobut-2-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1S,4S)-4-(4-methylphenyl)sulfonyl-3-(1,1,2,2-tetrafluoroethyl)cyclobut-2-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102498855 |
| Molecular Formula | C17H16F4O6S |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | dimethyl (1S,4S)-4-(4-methylphenyl)sulfonyl-3-(1,1,2,2-tetrafluoroethyl)cyclobut-2-ene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(F)(F)C(F)F)[C@@H](S(=O)(=O)c2ccc(C)cc2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C17H16F4O6S/c1-8-4-6-9(7-5-8)28(24,25)13-11(15(23)27-3)10(14(22)26-2)12(13)17(20,21)16(18)19/h4-7,11,13,16H,1-3H3/t11-,13+/m1/s1 |
| InChIKey | RTMYSTJXKIJHLF-YPMHNXCESA-N |
| XLogP | 2.31 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|