C11H19ClO2Si — CID 102498904
(1R)-7-chloro-7-methyl-1-trimethylsilyloxybicyclo[3.2.0]heptan-6-one (PubChem CID 102498904) has the molecular formula C11H19ClO2Si and a molecular weight of 246.81 g/mol. Its IUPAC name is (1R)-7-chloro-7-methyl-1-trimethylsilyloxybicyclo[3.2.0]heptan-6-one.
| Compound Name | (1R)-7-chloro-7-methyl-1-trimethylsilyloxybicyclo[3.2.0]heptan-6-one |
|---|---|
| PubChem CID | 102498904 |
| Molecular Formula | C11H19ClO2Si |
| Molecular Weight | 246.81 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | (1R)-7-chloro-7-methyl-1-trimethylsilyloxybicyclo[3.2.0]heptan-6-one |
| SMILES | CC1(Cl)C(=O)C2CCC[C@@]21O[Si](C)(C)C |
| InChI | InChI=1S/C11H19ClO2Si/c1-10(12)9(13)8-6-5-7-11(8,10)14-15(2,3)4/h8H,5-7H2,1-4H3/t8?,10?,11-/m1/s1 |
| InChIKey | STTIYWWJLVMEAQ-BOBPJJCASA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.81 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|