C14H20Br2O3Si — CID 11774576
(1R,2S,7R,8S)-1,12-dibromo-2-trimethylsilyloxy-9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one (PubChem CID 11774576) has the molecular formula C14H20Br2O3Si and a molecular weight of 424.21 g/mol. Its IUPAC name is (1R,2S,7R,8S)-1,12-dibromo-2-trimethylsilyloxy-9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one.
| Compound Name | (1R,2S,7R,8S)-1,12-dibromo-2-trimethylsilyloxy-9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one |
|---|---|
| PubChem CID | 11774576 |
| Molecular Formula | C14H20Br2O3Si |
| Molecular Weight | 424.21 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | (1R,2S,7R,8S)-1,12-dibromo-2-trimethylsilyloxy-9-oxatricyclo[6.2.2.02,7]dodec-11-en-10-one |
| SMILES | C[Si](C)(C)O[C@@]12CCCC[C@@H]1[C@@H]1OC(=O)[C@@]2(Br)C=C1Br |
| InChI | InChI=1S/C14H20Br2O3Si/c1-20(2,3)19-14-7-5-4-6-9(14)11-10(15)8-13(14,16)12(17)18-11/h8-9,11H,4-7H2,1-3H3/t9-,11+,13+,14+/m1/s1 |
| InChIKey | DGKDWHPBSKHTMX-OJDJGZDQSA-N |
| XLogP | 4.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.21 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|