C17H29BrO3Si — CID 139091540
(2R)-3-bromo-2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexyl]-2H-furan-5-one (PubChem CID 139091540) has the molecular formula C17H29BrO3Si and a molecular weight of 389.41 g/mol. Its IUPAC name is (2R)-3-bromo-2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexyl]-2H-furan-5-one.
| Compound Name | (2R)-3-bromo-2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 139091540 |
| Molecular Formula | C17H29BrO3Si |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (2R)-3-bromo-2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylcyclohexyl]-2H-furan-5-one |
| SMILES | C[C@@H]1CCCC[C@@]1(O[Si](C)(C)C(C)(C)C)[C@H]1OC(=O)C=C1Br |
| InChI | InChI=1S/C17H29BrO3Si/c1-12-9-7-8-10-17(12,15-13(18)11-14(19)20-15)21-22(5,6)16(2,3)4/h11-12,15H,7-10H2,1-6H3/t12-,15+,17+/m1/s1 |
| InChIKey | JZMWRPMFFHMZLV-PVUWLOKVSA-N |
| XLogP | 5.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|