C27H34N2O — CID 102499442
[(3R)-2-benzyl-4-butyl-3-cyclohexyl-3H-pyrazol-1-yl]-phenylmethanone (PubChem CID 102499442) has the molecular formula C27H34N2O and a molecular weight of 402.58 g/mol. Its IUPAC name is [(3R)-2-benzyl-4-butyl-3-cyclohexyl-3H-pyrazol-1-yl]-phenylmethanone.
| Compound Name | [(3R)-2-benzyl-4-butyl-3-cyclohexyl-3H-pyrazol-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 102499442 |
| Molecular Formula | C27H34N2O |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | [(3R)-2-benzyl-4-butyl-3-cyclohexyl-3H-pyrazol-1-yl]-phenylmethanone |
| SMILES | CCCCC1=CN(C(=O)c2ccccc2)N(Cc2ccccc2)[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C27H34N2O/c1-2-3-15-25-21-29(27(30)24-18-11-6-12-19-24)28(20-22-13-7-4-8-14-22)26(25)23-16-9-5-10-17-23/h4,6-8,11-14,18-19,21,23,26H,2-3,5,9-10,15-17,20H2,1H3/t26-/m1/s1 |
| InChIKey | UTXSAAWQCDEOPS-AREMUKBSSA-N |
| XLogP | 6.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |